C19H39FO3Si2 — CID 156903643
(1S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-methylidenecyclopentan-1-ol (PubChem CID 156903643) has the molecular formula C19H39FO3Si2 and a molecular weight of 390.69 g/mol. Its IUPAC name is (1S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-methylidenecyclopentan-1-ol.
| Compound Name | (1S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-methylidenecyclopentan-1-ol |
|---|---|
| PubChem CID | 156903643 |
| Molecular Formula | C19H39FO3Si2 |
| Molecular Weight | 390.69 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (1S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-2-methylidenecyclopentan-1-ol |
| SMILES | C=C1[C@@H](O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]1(F)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H39FO3Si2/c1-14-15(21)12-16(23-25(10,11)18(5,6)7)19(14,20)13-22-24(8,9)17(2,3)4/h15-16,21H,1,12-13H2,2-11H3/t15-,16-,19+/m0/s1 |
| InChIKey | ALYONQMCTKWHHD-TXPKVOOTSA-N |
| XLogP | 5.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.69 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|