C18H33NO2 — CID 156905643
[(1R,5S)-5-(hydroxymethyl)-3-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]cyclohex-3-en-1-yl]methanol (PubChem CID 156905643) has the molecular formula C18H33NO2 and a molecular weight of 295.47 g/mol. Its IUPAC name is [(1R,5S)-5-(hydroxymethyl)-3-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]cyclohex-3-en-1-yl]methanol.
| Compound Name | [(1R,5S)-5-(hydroxymethyl)-3-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]cyclohex-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 156905643 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | [(1R,5S)-5-(hydroxymethyl)-3-[(2,2,6,6-tetramethylpiperidin-1-yl)methyl]cyclohex-3-en-1-yl]methanol |
| SMILES | CC1(C)CCCC(C)(C)N1CC1=C[C@@H](CO)C[C@@H](CO)C1 |
| InChI | InChI=1S/C18H33NO2/c1-17(2)6-5-7-18(3,4)19(17)11-14-8-15(12-20)10-16(9-14)13-21/h8,15-16,20-21H,5-7,9-13H2,1-4H3/t15-,16+/m1/s1 |
| InChIKey | FBLYBYWGPVXBAT-CVEARBPZSA-N |
| XLogP | 2.97 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|