C22H10N2O8 — CID 156905742
3,12-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(18),2,4,6(20),7,9,11,13,15(19),16-decaene-4,5,7,8-tetracarboxylic acid (PubChem CID 156905742) has the molecular formula C22H10N2O8 and a molecular weight of 430.33 g/mol. Its IUPAC name is 3,12-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(18),2,4,6(20),7,9,11,13,15(19),16-decaene-4,5,7,8-tetracarboxylic acid.
| Compound Name | 3,12-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(18),2,4,6(20),7,9,11,13,15(19),16-decaene-4,5,7,8-tetracarboxylic acid |
|---|---|
| PubChem CID | 156905742 |
| Molecular Formula | C22H10N2O8 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 3,12-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(18),2,4,6(20),7,9,11,13,15(19),16-decaene-4,5,7,8-tetracarboxylic acid |
| SMILES | O=C(O)c1cc2c3nccc4cccc(c5nc(C(=O)O)c(C(=O)O)c(c1C(=O)O)c25)c43 |
| InChI | InChI=1S/C22H10N2O8/c25-19(26)10-6-9-12-14(13(10)20(27)28)15(21(29)30)18(22(31)32)24-17(12)8-3-1-2-7-4-5-23-16(9)11(7)8/h1-6H,(H,25,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | KTXAVVUJBXYPQO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 174.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|