C17H12F2N2O — CID 156906721
2-(3,5-difluorophenyl)-N-isoquinolin-4-ylacetamide (PubChem CID 156906721) has the molecular formula C17H12F2N2O and a molecular weight of 298.29 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-N-isoquinolin-4-ylacetamide.
| Compound Name | 2-(3,5-difluorophenyl)-N-isoquinolin-4-ylacetamide |
|---|---|
| PubChem CID | 156906721 |
| Molecular Formula | C17H12F2N2O |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-(3,5-difluorophenyl)-N-isoquinolin-4-ylacetamide |
| SMILES | O=C(Cc1cc(F)cc(F)c1)Nc1cncc2ccccc12 |
| InChI | InChI=1S/C17H12F2N2O/c18-13-5-11(6-14(19)8-13)7-17(22)21-16-10-20-9-12-3-1-2-4-15(12)16/h1-6,8-10H,7H2,(H,21,22) |
| InChIKey | RXQWWUHGRJKJHB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |