C24H29N5O2 — CID 156907170
2-(benzotriazol-1-yl)-N-(oxolan-3-ylmethyl)-N-(4-piperidin-4-ylphenyl)acetamide (PubChem CID 156907170) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-(oxolan-3-ylmethyl)-N-(4-piperidin-4-ylphenyl)acetamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-(oxolan-3-ylmethyl)-N-(4-piperidin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 156907170 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-(oxolan-3-ylmethyl)-N-(4-piperidin-4-ylphenyl)acetamide |
| SMILES | O=C(Cn1nnc2ccccc21)N(CC1CCOC1)c1ccc(C2CCNCC2)cc1 |
| InChI | InChI=1S/C24H29N5O2/c30-24(16-29-23-4-2-1-3-22(23)26-27-29)28(15-18-11-14-31-17-18)21-7-5-19(6-8-21)20-9-12-25-13-10-20/h1-8,18,20,25H,9-17H2 |
| InChIKey | LMMWTTCCOPOMID-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |