C31H37N5O3S — CID 156907568
N-[(4,6-dimethyl-2-oxo-3H-pyridin-3-yl)methyl]-6-methyl-5-(1-morpholin-4-ylethyl)-2-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)indolizine-7-carboxamide (PubChem CID 156907568) has the molecular formula C31H37N5O3S and a molecular weight of 559.74 g/mol. Its IUPAC name is N-[(4,6-dimethyl-2-oxo-3H-pyridin-3-yl)methyl]-6-methyl-5-(1-morpholin-4-ylethyl)-2-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)indolizine-7-carboxamide.
| Compound Name | N-[(4,6-dimethyl-2-oxo-3H-pyridin-3-yl)methyl]-6-methyl-5-(1-morpholin-4-ylethyl)-2-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)indolizine-7-carboxamide |
|---|---|
| PubChem CID | 156907568 |
| Molecular Formula | C31H37N5O3S |
| Molecular Weight | 559.74 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | N-[(4,6-dimethyl-2-oxo-3H-pyridin-3-yl)methyl]-6-methyl-5-(1-morpholin-4-ylethyl)-2-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)indolizine-7-carboxamide |
| SMILES | CC1=CC(C)=NC(=O)C1CNC(=O)c1cc2cc(-c3cc4c(s3)CCNC4)cn2c(C(C)N2CCOCC2)c1C |
| InChI | InChI=1S/C31H37N5O3S/c1-18-11-19(2)34-31(38)26(18)16-33-30(37)25-14-24-12-23(28-13-22-15-32-6-5-27(22)40-28)17-36(24)29(20(25)3)21(4)35-7-9-39-10-8-35/h11-14,17,21,26,32H,5-10,15-16H2,1-4H3,(H,33,37) |
| InChIKey | PAQJUNUYYFGNTI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.74 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |