About N,N-dimethyl-N'-phenylmethanimidamide
N,N-dimethyl-N'-phenylmethanimidamide (PubChem CID 15692) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is N,N-dimethyl-N'-phenylmethanimidamide.
Molecular Properties
| Compound Name | N,N-dimethyl-N'-phenylmethanimidamide |
| PubChem CID | 15692 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | N,N-dimethyl-N'-phenylmethanimidamide |
| SMILES | CN(C)/C=N/c1ccccc1 |
| InChI | InChI=1S/C9H12N2/c1-11(2)8-10-9-6-4-3-5-7-9/h3-8H,1-2H3/b10-8+ |
| InChIKey | SRPCLECGIYMIMN-CSKARUKUSA-N |
| XLogP | 1.91 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-N'-phenylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-N'-phenylmethanimidamide?
The IUPAC name of N,N-dimethyl-N'-phenylmethanimidamide (CID 15692) is N,N-dimethyl-N'-phenylmethanimidamide.
What is the SMILES notation for N,N-dimethyl-N'-phenylmethanimidamide?
The canonical SMILES for N,N-dimethyl-N'-phenylmethanimidamide is CN(C)/C=N/c1ccccc1.
What is the InChIKey of N,N-dimethyl-N'-phenylmethanimidamide?
The InChIKey is SRPCLECGIYMIMN-CSKARUKUSA-N. The full InChI is InChI=1S/C9H12N2/c1-11(2)8-10-9-6-4-3-5-7-9/h3-8H,1-2H3/b10-8+.
What are the key properties of N,N-dimethyl-N'-phenylmethanimidamide?
N,N-dimethyl-N'-phenylmethanimidamide has a molecular weight of 148.21 g/mol, XLogP of 1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-N'-phenylmethanimidamide is sourced from PubChem (CID 15692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).