C29H45NO5 — CID 156962510
3-[(4E,7E,11E,13E,16E,19E)-10-hydroxydocosa-4,7,11,13,16,19-hexaenoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156962510) has the molecular formula C29H45NO5 and a molecular weight of 487.68 g/mol. Its IUPAC name is 3-[(4E,7E,11E,13E,16E,19E)-10-hydroxydocosa-4,7,11,13,16,19-hexaenoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(4E,7E,11E,13E,16E,19E)-10-hydroxydocosa-4,7,11,13,16,19-hexaenoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156962510 |
| Molecular Formula | C29H45NO5 |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.33 |
| IUPAC Name | 3-[(4E,7E,11E,13E,16E,19E)-10-hydroxydocosa-4,7,11,13,16,19-hexaenoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C=C/C(O)C/C=C/C/C=C/CCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C29H45NO5/c1-5-6-7-8-9-10-11-12-15-18-21-26(31)22-19-16-13-14-17-20-23-29(34)35-27(24-28(32)33)25-30(2,3)4/h6-7,9-10,12,14-19,21,26-27,31H,5,8,11,13,20,22-25H2,1-4H3/b7-6+,10-9+,15-12+,17-14+,19-16+,21-18+ |
| InChIKey | ZCBYIOHHMZUQMV-OQKGYHBPSA-N |
| XLogP | 4.19 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|