C29H46NO5+ — CID 156962517
[3-carboxy-2-[(4E,7E,10E,13E,17E,19E)-16-hydroxydocosa-4,7,10,13,17,19-hexaenoyl]oxypropyl]-trimethylazanium (PubChem CID 156962517) has the molecular formula C29H46NO5+ and a molecular weight of 488.69 g/mol. Its IUPAC name is [3-carboxy-2-[(4E,7E,10E,13E,17E,19E)-16-hydroxydocosa-4,7,10,13,17,19-hexaenoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(4E,7E,10E,13E,17E,19E)-16-hydroxydocosa-4,7,10,13,17,19-hexaenoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962517 |
| Molecular Formula | C29H46NO5+ |
| Molecular Weight | 488.69 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | [3-carboxy-2-[(4E,7E,10E,13E,17E,19E)-16-hydroxydocosa-4,7,10,13,17,19-hexaenoyl]oxypropyl]-trimethylazanium |
| SMILES | CC/C=C/C=C/C(O)C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C29H45NO5/c1-5-6-7-18-21-26(31)22-19-16-14-12-10-8-9-11-13-15-17-20-23-29(34)35-27(24-28(32)33)25-30(2,3)4/h6-7,9-12,15-19,21,26-27,31H,5,8,13-14,20,22-25H2,1-4H3/p+1/b7-6+,11-9+,12-10+,17-15+,19-16+,21-18+ |
| InChIKey | YRSFEIALEMLSNL-LQWLKEIUSA-O |
| XLogP | 5.53 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.69 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|