C29H46NO7+ — CID 156962844
[3-carboxy-2-[(4E,7E,11E)-10-hydroxy-12-[5-hydroxy-3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]dodeca-4,7,11-trienoyl]oxypropyl]-trimethylazanium (PubChem CID 156962844) has the molecular formula C29H46NO7+ and a molecular weight of 520.69 g/mol. Its IUPAC name is [3-carboxy-2-[(4E,7E,11E)-10-hydroxy-12-[5-hydroxy-3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]dodeca-4,7,11-trienoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(4E,7E,11E)-10-hydroxy-12-[5-hydroxy-3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]dodeca-4,7,11-trienoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962844 |
| Molecular Formula | C29H46NO7+ |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | [3-carboxy-2-[(4E,7E,11E)-10-hydroxy-12-[5-hydroxy-3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]dodeca-4,7,11-trienoyl]oxypropyl]-trimethylazanium |
| SMILES | CC/C=C/CC1C(=O)CC(O)C1/C=C/C(O)C/C=C/C/C=C/CCC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C29H45NO7/c1-5-6-11-15-24-25(27(33)20-26(24)32)18-17-22(31)14-12-9-7-8-10-13-16-29(36)37-23(19-28(34)35)21-30(2,3)4/h6,8-12,17-18,22-25,27,31,33H,5,7,13-16,19-21H2,1-4H3/p+1/b10-8+,11-6+,12-9+,18-17+ |
| InChIKey | YPKGWXVJAWQRPF-MFNRHLQOSA-O |
| XLogP | 3.59 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|