C27H46NO7+ — CID 156962961
[3-carboxy-2-[(E)-7-[3,5-dihydroxy-2-[(1E,5Z)-3-hydroxyocta-1,5-dienyl]cyclopentyl]hept-5-enoyl]oxypropyl]-trimethylazanium (PubChem CID 156962961) has the molecular formula C27H46NO7+ and a molecular weight of 496.67 g/mol. Its IUPAC name is [3-carboxy-2-[(E)-7-[3,5-dihydroxy-2-[(1E,5Z)-3-hydroxyocta-1,5-dienyl]cyclopentyl]hept-5-enoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(E)-7-[3,5-dihydroxy-2-[(1E,5Z)-3-hydroxyocta-1,5-dienyl]cyclopentyl]hept-5-enoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962961 |
| Molecular Formula | C27H46NO7+ |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.33 |
| IUPAC Name | [3-carboxy-2-[(E)-7-[3,5-dihydroxy-2-[(1E,5Z)-3-hydroxyocta-1,5-dienyl]cyclopentyl]hept-5-enoyl]oxypropyl]-trimethylazanium |
| SMILES | CC/C=C\CC(O)/C=C/C1C(O)CC(O)C1C/C=C/CCCC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C27H45NO7/c1-5-6-9-12-20(29)15-16-23-22(24(30)18-25(23)31)13-10-7-8-11-14-27(34)35-21(17-26(32)33)19-28(2,3)4/h6-7,9-10,15-16,20-25,29-31H,5,8,11-14,17-19H2,1-4H3/p+1/b9-6-,10-7+,16-15+ |
| InChIKey | AINXNBZBNISPKQ-JNMJJDSHSA-O |
| XLogP | 2.83 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|