C27H48NO7+ — CID 156962991
[3-carboxy-2-[7-[5-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]propyl]-trimethylazanium (PubChem CID 156962991) has the molecular formula C27H48NO7+ and a molecular weight of 498.68 g/mol. Its IUPAC name is [3-carboxy-2-[7-[5-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]propyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[7-[5-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962991 |
| Molecular Formula | C27H48NO7+ |
| Molecular Weight | 498.68 g/mol |
| Exact Mass | 498.34 |
| IUPAC Name | [3-carboxy-2-[7-[5-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]propyl]-trimethylazanium |
| SMILES | CCCCCC(O)/C=C/C1C(=O)CC(O)C1CCCCCCC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C27H47NO7/c1-5-6-9-12-20(29)15-16-23-22(24(30)18-25(23)31)13-10-7-8-11-14-27(34)35-21(17-26(32)33)19-28(2,3)4/h15-16,20-24,29-30H,5-14,17-19H2,1-4H3/p+1/b16-15+ |
| InChIKey | KUXKCGFRIKNJJD-FOCLMDBBSA-O |
| XLogP | 3.48 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.68 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|