C27H47NO7 — CID 156962990
3-[7-[5-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]-4-(trimethylazaniumyl)butanoate (PubChem CID 156962990) has the molecular formula C27H47NO7 and a molecular weight of 497.67 g/mol. Its IUPAC name is 3-[7-[5-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[7-[5-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156962990 |
| Molecular Formula | C27H47NO7 |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.34 |
| IUPAC Name | 3-[7-[5-hydroxy-2-[(E)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCC(O)/C=C/C1C(=O)CC(O)C1CCCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C27H47NO7/c1-5-6-9-12-20(29)15-16-23-22(24(30)18-25(23)31)13-10-7-8-11-14-27(34)35-21(17-26(32)33)19-28(2,3)4/h15-16,20-24,29-30H,5-14,17-19H2,1-4H3/b16-15+ |
| InChIKey | KUXKCGFRIKNJJD-FOCLMDBBSA-N |
| XLogP | 2.15 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|