C31H55O11P — CID 156970033
[(2R)-2-[7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]-3-phosphonooxypropyl] octanoate (PubChem CID 156970033) has the molecular formula C31H55O11P and a molecular weight of 634.74 g/mol. Its IUPAC name is [(2R)-2-[7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]-3-phosphonooxypropyl] octanoate.
| Compound Name | [(2R)-2-[7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]-3-phosphonooxypropyl] octanoate |
|---|---|
| PubChem CID | 156970033 |
| Molecular Formula | C31H55O11P |
| Molecular Weight | 634.74 g/mol |
| Exact Mass | 634.35 |
| IUPAC Name | [(2R)-2-[7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]-3-phosphonooxypropyl] octanoate |
| SMILES | CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCC[C@H]1[C@@H](O)CC(=O)[C@@H]1/C=C/[C@@H](O)CCCCC |
| InChI | InChI=1S/C31H55O11P/c1-3-5-7-8-13-17-30(35)40-22-25(23-41-43(37,38)39)42-31(36)18-14-10-9-12-16-26-27(29(34)21-28(26)33)20-19-24(32)15-11-6-4-2/h19-20,24-28,32-33H,3-18,21-23H2,1-2H3,(H2,37,38,39)/b20-19+/t24-,25+,26+,27+,28-/m0/s1 |
| InChIKey | XKZIUONYUHABDV-AOOFNFKUSA-N |
| XLogP | 5.32 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.74 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|