C41H73O11P — CID 156967127
[(2R)-2-[7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]-3-phosphonooxypropyl] (Z)-octadec-11-enoate (PubChem CID 156967127) has the molecular formula C41H73O11P and a molecular weight of 773.00 g/mol. Its IUPAC name is [(2R)-2-[7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]-3-phosphonooxypropyl] (Z)-octadec-11-enoate.
| Compound Name | [(2R)-2-[7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]-3-phosphonooxypropyl] (Z)-octadec-11-enoate |
|---|---|
| PubChem CID | 156967127 |
| Molecular Formula | C41H73O11P |
| Molecular Weight | 773.00 g/mol |
| Exact Mass | 772.49 |
| IUPAC Name | [(2R)-2-[7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]-3-phosphonooxypropyl] (Z)-octadec-11-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCC[C@H]1[C@@H](O)CC(=O)[C@@H]1/C=C/[C@@H](O)CCCCC |
| InChI | InChI=1S/C41H73O11P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-23-27-40(45)50-32-35(33-51-53(47,48)49)52-41(46)28-24-20-19-22-26-36-37(39(44)31-38(36)43)30-29-34(42)25-21-6-4-2/h10-11,29-30,34-38,42-43H,3-9,12-28,31-33H2,1-2H3,(H2,47,48,49)/b11-10-,30-29+/t34-,35+,36+,37+,38-/m0/s1 |
| InChIKey | NZZHLRBFPJXMIU-TYSOXIIRSA-N |
| XLogP | 8.99 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.00 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|