C41H72NO10P — CID 156964379
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-hexadec-9-enoyl]oxypropyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate (PubChem CID 156964379) has the molecular formula C41H72NO10P and a molecular weight of 770.00 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-hexadec-9-enoyl]oxypropyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-hexadec-9-enoyl]oxypropyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate |
|---|---|
| PubChem CID | 156964379 |
| Molecular Formula | C41H72NO10P |
| Molecular Weight | 770.00 g/mol |
| Exact Mass | 769.49 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-hexadec-9-enoyl]oxypropyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate |
| SMILES | CCCCC/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C41H72NO10P/c1-3-5-7-9-11-12-13-14-15-16-17-19-25-31-41(46)52-39(36-51-53(47,48)50-34-33-42)35-49-40(45)32-26-30-38(44)29-24-21-20-23-28-37(43)27-22-18-10-8-6-4-2/h12-13,18,20-24,28-29,37-39,43-44H,3-11,14-17,19,25-27,30-36,42H2,1-2H3,(H,47,48)/b13-12-,21-20+,22-18-,28-23+,29-24-/t37-,38-,39-/m1/s1 |
| InChIKey | PXAHEJDCOOBYNG-TWWSRSLQSA-N |
| XLogP | 8.88 |
| TPSA | 174.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.00 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|