C43H76NO9P — CID 156988767
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(1E,11Z)-octadeca-1,11-dienoxy]propyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate (PubChem CID 156988767) has the molecular formula C43H76NO9P and a molecular weight of 782.05 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(1E,11Z)-octadeca-1,11-dienoxy]propyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(1E,11Z)-octadeca-1,11-dienoxy]propyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate |
|---|---|
| PubChem CID | 156988767 |
| Molecular Formula | C43H76NO9P |
| Molecular Weight | 782.05 g/mol |
| Exact Mass | 781.53 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(1E,11Z)-octadeca-1,11-dienoxy]propyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate |
| SMILES | CCCCC/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)OC[C@H](COP(=O)(O)OCCN)O/C=C/CCCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C43H76NO9P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-24-28-36-50-42(39-53-54(48,49)52-37-35-44)38-51-43(47)34-29-33-41(46)32-27-23-22-26-31-40(45)30-25-21-10-8-6-4-2/h12-13,21-23,25-28,31-32,36,40-42,45-46H,3-11,14-20,24,29-30,33-35,37-39,44H2,1-2H3,(H,48,49)/b13-12-,23-22+,25-21-,31-26+,32-27-,36-28+/t40-,41-,42-/m1/s1 |
| InChIKey | WWQKUUOQNFXRQN-NIRBSDSVSA-N |
| XLogP | 10.26 |
| TPSA | 157.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.05 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|