C41H78NO7P — CID 162801365
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadeca-1,11-dienoxypropyl] octadec-11-enoate (PubChem CID 162801365) has the molecular formula C41H78NO7P and a molecular weight of 728.05 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadeca-1,11-dienoxypropyl] octadec-11-enoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadeca-1,11-dienoxypropyl] octadec-11-enoate |
|---|---|
| PubChem CID | 162801365 |
| Molecular Formula | C41H78NO7P |
| Molecular Weight | 728.05 g/mol |
| Exact Mass | 727.55 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadeca-1,11-dienoxypropyl] octadec-11-enoate |
| SMILES | CCCCCCC=CCCCCCCCCC=CO[C@H](COC(=O)CCCCCCCCCC=CCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C41H78NO7P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-46-40(39-49-50(44,45)48-37-35-42)38-47-41(43)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h13-16,33,36,40H,3-12,17-32,34-35,37-39,42H2,1-2H3,(H,44,45)/t40-/m1/s1 |
| InChIKey | BIYXBOGKCFGRKR-RRHRGVEJSA-N |
| XLogP | 12.21 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.05 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|