C45H78NO9P — CID 156965335
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] (5Z,8Z,11Z,14Z,16E,18S)-18-hydroxyicosa-5,8,11,14,16-pentaenoate (PubChem CID 156965335) has the molecular formula C45H78NO9P and a molecular weight of 808.09 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] (5Z,8Z,11Z,14Z,16E,18S)-18-hydroxyicosa-5,8,11,14,16-pentaenoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] (5Z,8Z,11Z,14Z,16E,18S)-18-hydroxyicosa-5,8,11,14,16-pentaenoate |
|---|---|
| PubChem CID | 156965335 |
| Molecular Formula | C45H78NO9P |
| Molecular Weight | 808.09 g/mol |
| Exact Mass | 807.54 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] (5Z,8Z,11Z,14Z,16E,18S)-18-hydroxyicosa-5,8,11,14,16-pentaenoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\C=C\[C@@H](O)CC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C45H78NO9P/c1-3-5-6-7-8-9-10-11-12-13-14-19-22-25-28-31-34-37-45(49)55-43(41-54-56(50,51)53-39-38-46)40-52-44(48)36-33-30-27-24-21-18-16-15-17-20-23-26-29-32-35-42(47)4-2/h11-12,16-18,20,24,26-27,29,32,35,42-43,47H,3-10,13-15,19,21-23,25,28,30-31,33-34,36-41,46H2,1-2H3,(H,50,51)/b12-11-,18-16-,20-17-,27-24-,29-26-,35-32+/t42-,43+/m0/s1 |
| InChIKey | KNENZNNRRGVDFM-KDYDFMESSA-N |
| XLogP | 11.24 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.09 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|