C47H78NO9P — CID 156987400
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoyl]oxypropyl] (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoate (PubChem CID 156987400) has the molecular formula C47H78NO9P and a molecular weight of 832.11 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoyl]oxypropyl] (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoyl]oxypropyl] (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoate |
|---|---|
| PubChem CID | 156987400 |
| Molecular Formula | C47H78NO9P |
| Molecular Weight | 832.11 g/mol |
| Exact Mass | 831.54 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoyl]oxypropyl] (7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCC/C=C/C=C\C(O)C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C47H78NO9P/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-22-24-26-30-34-38-46(50)54-42-45(43-56-58(52,53)55-41-40-48)57-47(51)39-35-31-27-29-33-37-44(49)36-32-28-25-23-12-10-8-6-4-2/h11-13,15-16,18-19,21-23,27-29,32-33,37,44-45,49H,3-10,14,17,20,24-26,30-31,34-36,38-43,48H2,1-2H3,(H,52,53)/b13-11-,16-15-,19-18-,22-21-,23-12-,29-27+,32-28-,37-33-/t44?,45-/m1/s1 |
| InChIKey | VXRCOQOUJDDVMH-VTZWWKHASA-N |
| XLogP | 11.58 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.11 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|