C45H74NO9P — CID 156965713
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]oxypropyl] (5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoate (PubChem CID 156965713) has the molecular formula C45H74NO9P and a molecular weight of 804.06 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]oxypropyl] (5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]oxypropyl] (5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoate |
|---|---|
| PubChem CID | 156965713 |
| Molecular Formula | C45H74NO9P |
| Molecular Weight | 804.06 g/mol |
| Exact Mass | 803.51 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]oxypropyl] (5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O[C@H](COC(=O)CCC/C=C/C=C\C(O)C/C=C\C/C=C\CCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C45H74NO9P/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-22-24-28-33-37-45(49)55-43(41-54-56(50,51)53-39-38-46)40-52-44(48)36-32-29-25-27-31-35-42(47)34-30-26-23-21-12-10-8-6-4-2/h11-13,15-16,18-19,21-22,24-27,30-31,35,42-43,47H,3-10,14,17,20,23,28-29,32-34,36-41,46H2,1-2H3,(H,50,51)/b13-11-,16-15-,19-18-,21-12-,24-22-,27-25+,30-26-,35-31-/t42?,43-/m1/s1 |
| InChIKey | WYHCVYMPABOQLT-BUTNUCMOSA-N |
| XLogP | 10.80 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.06 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|