C45H80NO11P — CID 156965472
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]propyl] (11Z,14Z)-icosa-11,14-dienoate (PubChem CID 156965472) has the molecular formula C45H80NO11P and a molecular weight of 842.10 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]propyl] (11Z,14Z)-icosa-11,14-dienoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]propyl] (11Z,14Z)-icosa-11,14-dienoate |
|---|---|
| PubChem CID | 156965472 |
| Molecular Formula | C45H80NO11P |
| Molecular Weight | 842.10 g/mol |
| Exact Mass | 841.55 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoyloxy]propyl] (11Z,14Z)-icosa-11,14-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCC[C@H]1[C@@H](O)CC(=O)[C@@H]1/C=C/[C@@H](O)CCCCC |
| InChI | InChI=1S/C45H80NO11P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-29-44(50)54-36-39(37-56-58(52,53)55-34-33-46)57-45(51)30-26-22-21-24-28-40-41(43(49)35-42(40)48)32-31-38(47)27-23-6-4-2/h9-10,12-13,31-32,38-42,47-48H,3-8,11,14-30,33-37,46H2,1-2H3,(H,52,53)/b10-9-,13-12-,32-31+/t38-,39+,40+,41+,42-/m0/s1 |
| InChIKey | IHDONPMKANMUBV-OJBMRJKMSA-N |
| XLogP | 9.53 |
| TPSA | 191.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.10 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|