C43H78NO10P — CID 156988822
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(1E,11Z)-octadeca-1,11-dienoxy]propyl] 7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoate (PubChem CID 156988822) has the molecular formula C43H78NO10P and a molecular weight of 800.07 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(1E,11Z)-octadeca-1,11-dienoxy]propyl] 7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(1E,11Z)-octadeca-1,11-dienoxy]propyl] 7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 156988822 |
| Molecular Formula | C43H78NO10P |
| Molecular Weight | 800.07 g/mol |
| Exact Mass | 799.54 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(1E,11Z)-octadeca-1,11-dienoxy]propyl] 7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanoate |
| SMILES | CCCCCC/C=C\CCCCCCCC/C=C/O[C@H](COC(=O)CCCCCC[C@H]1[C@@H](O)CC(=O)[C@@H]1/C=C/[C@@H](O)CCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C43H78NO10P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-21-25-32-51-38(36-54-55(49,50)53-33-31-44)35-52-43(48)28-24-20-19-23-27-39-40(42(47)34-41(39)46)30-29-37(45)26-22-6-4-2/h10-11,25,29-30,32,37-41,45-46H,3-9,12-24,26-28,31,33-36,44H2,1-2H3,(H,49,50)/b11-10-,30-29+,32-25+/t37-,38+,39+,40+,41-/m0/s1 |
| InChIKey | TXNWXTCBRRQMAE-JJYNPPELSA-N |
| XLogP | 9.57 |
| TPSA | 174.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.07 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|