C37H63O9P — CID 156966421
[(2R)-3-phosphonooxy-2-[(Z)-tetradec-9-enoyl]oxypropyl] (5Z,8Z,11Z,14Z,18S)-18-hydroxyicosa-5,8,11,14-tetraenoate (PubChem CID 156966421) has the molecular formula C37H63O9P and a molecular weight of 682.88 g/mol. Its IUPAC name is [(2R)-3-phosphonooxy-2-[(Z)-tetradec-9-enoyl]oxypropyl] (5Z,8Z,11Z,14Z,18S)-18-hydroxyicosa-5,8,11,14-tetraenoate.
| Compound Name | [(2R)-3-phosphonooxy-2-[(Z)-tetradec-9-enoyl]oxypropyl] (5Z,8Z,11Z,14Z,18S)-18-hydroxyicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 156966421 |
| Molecular Formula | C37H63O9P |
| Molecular Weight | 682.88 g/mol |
| Exact Mass | 682.42 |
| IUPAC Name | [(2R)-3-phosphonooxy-2-[(Z)-tetradec-9-enoyl]oxypropyl] (5Z,8Z,11Z,14Z,18S)-18-hydroxyicosa-5,8,11,14-tetraenoate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CC[C@@H](O)CC)COP(=O)(O)O |
| InChI | InChI=1S/C37H63O9P/c1-3-5-6-7-8-9-14-19-22-25-28-31-37(40)46-35(33-45-47(41,42)43)32-44-36(39)30-27-24-21-18-16-13-11-10-12-15-17-20-23-26-29-34(38)4-2/h7-8,11-13,15,18,20-21,23,34-35,38H,3-6,9-10,14,16-17,19,22,24-33H2,1-2H3,(H2,41,42,43)/b8-7-,13-11-,15-12-,21-18-,23-20-/t34-,35+/m0/s1 |
| InChIKey | KJAGFJHOSUAGSH-OPAPKFSJSA-N |
| XLogP | 9.14 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.88 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|