C41H67O11P — CID 156967579
[(2R)-1-[(Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoyl]oxy-3-phosphonooxypropan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 156967579) has the molecular formula C41H67O11P and a molecular weight of 766.95 g/mol. Its IUPAC name is [(2R)-1-[(Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoyl]oxy-3-phosphonooxypropan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | [(2R)-1-[(Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoyl]oxy-3-phosphonooxypropan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 156967579 |
| Molecular Formula | C41H67O11P |
| Molecular Weight | 766.95 g/mol |
| Exact Mass | 766.44 |
| IUPAC Name | [(2R)-1-[(Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]hept-5-enoyl]oxy-3-phosphonooxypropan-2-yl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C\C[C@H]1[C@@H](O)CC(=O)[C@@H]1/C=C/[C@@H](O)CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C41H67O11P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-24-28-41(46)52-35(33-51-53(47,48)49)32-50-40(45)27-23-20-19-22-26-36-37(39(44)31-38(36)43)30-29-34(42)25-21-6-4-2/h5,7,9-10,12-13,19,22,29-30,34-38,42-43H,3-4,6,8,11,14-18,20-21,23-28,31-33H2,1-2H3,(H2,47,48,49)/b7-5-,10-9-,13-12-,22-19-,30-29+/t34-,35+,36+,37+,38-/m0/s1 |
| InChIKey | LRWSNEWWHGMLEL-MLXFOZTLSA-N |
| XLogP | 8.32 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.95 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|