C25H39O10P — CID 156969869
[(2R)-1-acetyloxy-3-phosphonooxypropan-2-yl] (Z)-7-[(1S,5R)-5-[(E,3S)-3-hydroxyoct-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoate (PubChem CID 156969869) has the molecular formula C25H39O10P and a molecular weight of 530.55 g/mol. Its IUPAC name is [(2R)-1-acetyloxy-3-phosphonooxypropan-2-yl] (Z)-7-[(1S,5R)-5-[(E,3S)-3-hydroxyoct-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoate.
| Compound Name | [(2R)-1-acetyloxy-3-phosphonooxypropan-2-yl] (Z)-7-[(1S,5R)-5-[(E,3S)-3-hydroxyoct-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 156969869 |
| Molecular Formula | C25H39O10P |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | [(2R)-1-acetyloxy-3-phosphonooxypropan-2-yl] (Z)-7-[(1S,5R)-5-[(E,3S)-3-hydroxyoct-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1C(=O)C=C[C@@H]1C/C=C\CCCC(=O)O[C@H](COC(C)=O)COP(=O)(O)O |
| InChI | InChI=1S/C25H39O10P/c1-3-4-7-11-21(27)14-15-23-20(13-16-24(23)28)10-8-5-6-9-12-25(29)35-22(17-33-19(2)26)18-34-36(30,31)32/h5,8,13-16,20-23,27H,3-4,6-7,9-12,17-18H2,1-2H3,(H2,30,31,32)/b8-5-,15-14+/t20-,21-,22+,23+/m0/s1 |
| InChIKey | DNANGVDVWKVQTM-AFBJFUDOSA-N |
| XLogP | 3.56 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|