C30H50NO10P — CID 156995428
[(2R)-3-acetyloxy-2-[(Z)-7-[(1S,5R)-5-[(E,3S)-3-hydroxyoct-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156995428) has the molecular formula C30H50NO10P and a molecular weight of 615.70 g/mol. Its IUPAC name is [(2R)-3-acetyloxy-2-[(Z)-7-[(1S,5R)-5-[(E,3S)-3-hydroxyoct-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-acetyloxy-2-[(Z)-7-[(1S,5R)-5-[(E,3S)-3-hydroxyoct-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156995428 |
| Molecular Formula | C30H50NO10P |
| Molecular Weight | 615.70 g/mol |
| Exact Mass | 615.32 |
| IUPAC Name | [(2R)-3-acetyloxy-2-[(Z)-7-[(1S,5R)-5-[(E,3S)-3-hydroxyoct-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1C(=O)C=C[C@@H]1C/C=C\CCCC(=O)O[C@H](COC(C)=O)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C30H50NO10P/c1-6-7-10-14-26(33)17-18-28-25(16-19-29(28)34)13-11-8-9-12-15-30(35)41-27(22-38-24(2)32)23-40-42(36,37)39-21-20-31(3,4)5/h8,11,16-19,25-28,33H,6-7,9-10,12-15,20-23H2,1-5H3/b11-8-,18-17+/t25-,26-,27+,28+/m0/s1 |
| InChIKey | XODZBDPFVDTKIE-JRXAHRHBSA-N |
| XLogP | 3.65 |
| TPSA | 148.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.70 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|