C48H84NO10P — CID 156991902
[(2R)-3-[(Z)-7-[(1S,5R)-5-[(E,3S)-3-hydroxyoct-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156991902) has the molecular formula C48H84NO10P and a molecular weight of 866.17 g/mol. Its IUPAC name is [(2R)-3-[(Z)-7-[(1S,5R)-5-[(E,3S)-3-hydroxyoct-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(Z)-7-[(1S,5R)-5-[(E,3S)-3-hydroxyoct-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156991902 |
| Molecular Formula | C48H84NO10P |
| Molecular Weight | 866.17 g/mol |
| Exact Mass | 865.58 |
| IUPAC Name | [(2R)-3-[(Z)-7-[(1S,5R)-5-[(E,3S)-3-hydroxyoct-1-enyl]-4-oxocyclopent-2-en-1-yl]hept-5-enoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C\C[C@H]1C=CC(=O)[C@@H]1/C=C/[C@@H](O)CCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C48H84NO10P/c1-6-8-10-11-12-13-14-15-16-17-18-19-20-21-22-23-29-33-48(53)59-44(41-58-60(54,55)57-39-38-49(3,4)5)40-56-47(52)32-28-25-24-27-30-42-34-37-46(51)45(42)36-35-43(50)31-26-9-7-2/h15-16,24,27,34-37,42-45,50H,6-14,17-23,25-26,28-33,38-41H2,1-5H3/b16-15-,27-24-,36-35+/t42-,43-,44+,45+/m0/s1 |
| InChIKey | SHRSSGUIEBBPEB-IAUTVUGGSA-N |
| XLogP | 10.45 |
| TPSA | 148.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.17 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|