C36H61O9P — CID 156970210
[(2R)-2-(10-methyldodecanoyloxy)-3-phosphonooxypropyl] (5Z,8Z,11Z,13E,17Z)-16-hydroxyicosa-5,8,11,13,17-pentaenoate (PubChem CID 156970210) has the molecular formula C36H61O9P and a molecular weight of 668.85 g/mol. Its IUPAC name is [(2R)-2-(10-methyldodecanoyloxy)-3-phosphonooxypropyl] (5Z,8Z,11Z,13E,17Z)-16-hydroxyicosa-5,8,11,13,17-pentaenoate.
| Compound Name | [(2R)-2-(10-methyldodecanoyloxy)-3-phosphonooxypropyl] (5Z,8Z,11Z,13E,17Z)-16-hydroxyicosa-5,8,11,13,17-pentaenoate |
|---|---|
| PubChem CID | 156970210 |
| Molecular Formula | C36H61O9P |
| Molecular Weight | 668.85 g/mol |
| Exact Mass | 668.41 |
| IUPAC Name | [(2R)-2-(10-methyldodecanoyloxy)-3-phosphonooxypropyl] (5Z,8Z,11Z,13E,17Z)-16-hydroxyicosa-5,8,11,13,17-pentaenoate |
| SMILES | CC/C=C\C(O)C/C=C/C=C\C/C=C\C/C=C\CCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCCCC(C)CC |
| InChI | InChI=1S/C36H61O9P/c1-4-6-26-33(37)27-22-18-13-11-9-7-8-10-12-14-19-23-28-35(38)43-30-34(31-44-46(40,41)42)45-36(39)29-24-20-16-15-17-21-25-32(3)5-2/h6-8,11-14,18,22,26,32-34,37H,4-5,9-10,15-17,19-21,23-25,27-31H2,1-3H3,(H2,40,41,42)/b8-7-,13-11-,14-12-,22-18+,26-6-/t32?,33?,34-/m1/s1 |
| InChIKey | OWKPYMRGTBVUGE-PLUYOSPRSA-N |
| XLogP | 8.61 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.85 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|