C41H63O9P — CID 156967719
[(2R)-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxy-3-phosphonooxypropyl] (5Z,8Z,11Z,13E,17Z)-16-hydroxyicosa-5,8,11,13,17-pentaenoate (PubChem CID 156967719) has the molecular formula C41H63O9P and a molecular weight of 730.92 g/mol. Its IUPAC name is [(2R)-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxy-3-phosphonooxypropyl] (5Z,8Z,11Z,13E,17Z)-16-hydroxyicosa-5,8,11,13,17-pentaenoate.
| Compound Name | [(2R)-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxy-3-phosphonooxypropyl] (5Z,8Z,11Z,13E,17Z)-16-hydroxyicosa-5,8,11,13,17-pentaenoate |
|---|---|
| PubChem CID | 156967719 |
| Molecular Formula | C41H63O9P |
| Molecular Weight | 730.92 g/mol |
| Exact Mass | 730.42 |
| IUPAC Name | [(2R)-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxy-3-phosphonooxypropyl] (5Z,8Z,11Z,13E,17Z)-16-hydroxyicosa-5,8,11,13,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)O[C@H](COC(=O)CCC/C=C\C/C=C\C/C=C\C=C\CC(O)/C=C\CC)COP(=O)(O)O |
| InChI | InChI=1S/C41H63O9P/c1-3-5-7-8-9-10-11-12-13-14-19-22-25-28-31-35-41(44)50-39(37-49-51(45,46)47)36-48-40(43)34-30-27-24-21-18-16-15-17-20-23-26-29-33-38(42)32-6-4-2/h5-7,9-10,12-13,15-16,19-24,26,29,32,38-39,42H,3-4,8,11,14,17-18,25,27-28,30-31,33-37H2,1-2H3,(H2,45,46,47)/b7-5-,10-9-,13-12-,16-15-,22-19-,23-20-,24-21-,29-26+,32-6-/t38?,39-/m1/s1 |
| InChIKey | YJPZHACNHJKMHT-XZZPRFDASA-N |
| XLogP | 9.81 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.92 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|