C43H67O9P — CID 156967529
[(2R)-1-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropan-2-yl] (4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoate (PubChem CID 156967529) has the molecular formula C43H67O9P and a molecular weight of 758.97 g/mol. Its IUPAC name is [(2R)-1-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropan-2-yl] (4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoate.
| Compound Name | [(2R)-1-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropan-2-yl] (4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoate |
|---|---|
| PubChem CID | 156967529 |
| Molecular Formula | C43H67O9P |
| Molecular Weight | 758.97 g/mol |
| Exact Mass | 758.45 |
| IUPAC Name | [(2R)-1-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropan-2-yl] (4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\CC(O)/C=C/C=C\C/C=C\C/C=C\CCC(=O)O[C@H](COC(=O)CCCC/C=C\C/C=C\C/C=C\CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C43H67O9P/c1-3-5-7-9-11-12-13-14-15-16-17-21-24-28-32-36-42(45)50-38-41(39-51-53(47,48)49)52-43(46)37-33-29-25-22-19-18-20-23-27-31-35-40(44)34-30-26-10-8-6-4-2/h6,8,11-12,14-15,17-19,21,23,25-27,29-31,35,40-41,44H,3-5,7,9-10,13,16,20,22,24,28,32-34,36-39H2,1-2H3,(H2,47,48,49)/b8-6-,12-11-,15-14-,19-18-,21-17-,27-23-,29-25-,30-26-,35-31+/t40?,41-/m1/s1 |
| InChIKey | LKXIYOAYEVFSCS-UCBZTRAUSA-N |
| XLogP | 10.59 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.97 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|