C35H57O9P — CID 156966074
[(2R)-2-decanoyloxy-3-phosphonooxypropyl] (4Z,8Z,10Z,13Z,16Z,19Z)-7-hydroxydocosa-4,8,10,13,16,19-hexaenoate (PubChem CID 156966074) has the molecular formula C35H57O9P and a molecular weight of 652.81 g/mol. Its IUPAC name is [(2R)-2-decanoyloxy-3-phosphonooxypropyl] (4Z,8Z,10Z,13Z,16Z,19Z)-7-hydroxydocosa-4,8,10,13,16,19-hexaenoate.
| Compound Name | [(2R)-2-decanoyloxy-3-phosphonooxypropyl] (4Z,8Z,10Z,13Z,16Z,19Z)-7-hydroxydocosa-4,8,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 156966074 |
| Molecular Formula | C35H57O9P |
| Molecular Weight | 652.81 g/mol |
| Exact Mass | 652.37 |
| IUPAC Name | [(2R)-2-decanoyloxy-3-phosphonooxypropyl] (4Z,8Z,10Z,13Z,16Z,19Z)-7-hydroxydocosa-4,8,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C=C/C(O)C/C=C\CCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C35H57O9P/c1-3-5-7-9-11-12-13-14-15-16-18-19-22-26-32(36)27-23-21-25-28-34(37)42-30-33(31-43-45(39,40)41)44-35(38)29-24-20-17-10-8-6-4-2/h5,7,11-12,14-15,18-19,21-23,26,32-33,36H,3-4,6,8-10,13,16-17,20,24-25,27-31H2,1-2H3,(H2,39,40,41)/b7-5-,12-11-,15-14-,19-18-,23-21-,26-22-/t32?,33-/m1/s1 |
| InChIKey | HVWRTDRQFSGFDP-PPEGXNPVSA-N |
| XLogP | 8.14 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.81 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|