C43H69O10P — CID 156967326
[(2R)-2-[(9Z,11Z)-octadeca-9,11-dienoyl]oxy-3-phosphonooxypropyl] (4Z,7Z,10S,11E,13Z,15E,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoate (PubChem CID 156967326) has the molecular formula C43H69O10P and a molecular weight of 776.99 g/mol. Its IUPAC name is [(2R)-2-[(9Z,11Z)-octadeca-9,11-dienoyl]oxy-3-phosphonooxypropyl] (4Z,7Z,10S,11E,13Z,15E,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoate.
| Compound Name | [(2R)-2-[(9Z,11Z)-octadeca-9,11-dienoyl]oxy-3-phosphonooxypropyl] (4Z,7Z,10S,11E,13Z,15E,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoate |
|---|---|
| PubChem CID | 156967326 |
| Molecular Formula | C43H69O10P |
| Molecular Weight | 776.99 g/mol |
| Exact Mass | 776.46 |
| IUPAC Name | [(2R)-2-[(9Z,11Z)-octadeca-9,11-dienoyl]oxy-3-phosphonooxypropyl] (4Z,7Z,10S,11E,13Z,15E,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoate |
| SMILES | CC/C=C\C[C@@H](O)/C=C/C=C\C=C\[C@@H](O)C/C=C\C/C=C\CCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCC/C=C\C=C/CCCCCC |
| InChI | InChI=1S/C43H69O10P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-22-30-36-43(47)53-41(38-52-54(48,49)50)37-51-42(46)35-29-21-19-18-20-26-32-40(45)34-28-24-23-27-33-39(44)31-25-6-4-2/h6,10-13,19-21,23-28,33-34,39-41,44-45H,3-5,7-9,14-18,22,29-32,35-38H2,1-2H3,(H2,48,49,50)/b11-10-,13-12-,21-19-,24-23-,25-6-,26-20-,33-27+,34-28+/t39-,40+,41-/m1/s1 |
| InChIKey | GMUOEVORJKMQDN-GCHPYXBGSA-N |
| XLogP | 9.78 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.99 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|