C45H73O10P — CID 156968260
[(2R)-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-3-phosphonooxypropyl] (4Z,7Z,10S,11E,13Z,15E,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoate (PubChem CID 156968260) has the molecular formula C45H73O10P and a molecular weight of 805.04 g/mol. Its IUPAC name is [(2R)-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-3-phosphonooxypropyl] (4Z,7Z,10S,11E,13Z,15E,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoate.
| Compound Name | [(2R)-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-3-phosphonooxypropyl] (4Z,7Z,10S,11E,13Z,15E,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoate |
|---|---|
| PubChem CID | 156968260 |
| Molecular Formula | C45H73O10P |
| Molecular Weight | 805.04 g/mol |
| Exact Mass | 804.49 |
| IUPAC Name | [(2R)-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxy-3-phosphonooxypropyl] (4Z,7Z,10S,11E,13Z,15E,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoate |
| SMILES | CC/C=C\C[C@@H](O)/C=C/C=C\C=C\[C@@H](O)C/C=C\C/C=C\CCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C45H73O10P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-24-32-38-45(49)55-43(40-54-56(50,51)52)39-53-44(48)37-31-23-21-20-22-28-34-42(47)36-30-26-25-29-35-41(46)33-27-6-4-2/h6,9-10,12-13,21-23,25-30,35-36,41-43,46-47H,3-5,7-8,11,14-20,24,31-34,37-40H2,1-2H3,(H2,50,51,52)/b10-9-,13-12-,23-21-,26-25-,27-6-,28-22-,35-29+,36-30+/t41-,42+,43-/m1/s1 |
| InChIKey | OMZDBKOWWWCCDK-IZVDSOHWSA-N |
| XLogP | 10.56 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.04 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|