C39H63O9P — CID 156966488
[(2R)-1-phosphonooxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (4Z,8Z,10Z,13Z,16Z,19Z)-7-hydroxydocosa-4,8,10,13,16,19-hexaenoate (PubChem CID 156966488) has the molecular formula C39H63O9P and a molecular weight of 706.90 g/mol. Its IUPAC name is [(2R)-1-phosphonooxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (4Z,8Z,10Z,13Z,16Z,19Z)-7-hydroxydocosa-4,8,10,13,16,19-hexaenoate.
| Compound Name | [(2R)-1-phosphonooxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (4Z,8Z,10Z,13Z,16Z,19Z)-7-hydroxydocosa-4,8,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 156966488 |
| Molecular Formula | C39H63O9P |
| Molecular Weight | 706.90 g/mol |
| Exact Mass | 706.42 |
| IUPAC Name | [(2R)-1-phosphonooxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (4Z,8Z,10Z,13Z,16Z,19Z)-7-hydroxydocosa-4,8,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C=C/C(O)C/C=C\CCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\CCCC)COP(=O)(O)O |
| InChI | InChI=1S/C39H63O9P/c1-3-5-7-9-11-13-15-16-18-19-21-23-26-30-36(40)31-27-25-29-33-39(42)48-37(35-47-49(43,44)45)34-46-38(41)32-28-24-22-20-17-14-12-10-8-6-4-2/h5,7,10-13,16,18,21,23,25-27,30,36-37,40H,3-4,6,8-9,14-15,17,19-20,22,24,28-29,31-35H2,1-2H3,(H2,43,44,45)/b7-5-,12-10-,13-11-,18-16-,23-21-,27-25-,30-26-/t36?,37-/m1/s1 |
| InChIKey | GRESTBCXLJVQHS-XUAKTQADSA-N |
| XLogP | 9.48 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.90 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|