C41H65O9P — CID 156967612
[(2R)-1-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy-3-phosphonooxypropan-2-yl] (5Z,8Z,11Z,14Z,16E,18R)-18-hydroxyicosa-5,8,11,14,16-pentaenoate (PubChem CID 156967612) has the molecular formula C41H65O9P and a molecular weight of 732.94 g/mol. Its IUPAC name is [(2R)-1-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy-3-phosphonooxypropan-2-yl] (5Z,8Z,11Z,14Z,16E,18R)-18-hydroxyicosa-5,8,11,14,16-pentaenoate.
| Compound Name | [(2R)-1-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy-3-phosphonooxypropan-2-yl] (5Z,8Z,11Z,14Z,16E,18R)-18-hydroxyicosa-5,8,11,14,16-pentaenoate |
|---|---|
| PubChem CID | 156967612 |
| Molecular Formula | C41H65O9P |
| Molecular Weight | 732.94 g/mol |
| Exact Mass | 732.44 |
| IUPAC Name | [(2R)-1-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy-3-phosphonooxypropan-2-yl] (5Z,8Z,11Z,14Z,16E,18R)-18-hydroxyicosa-5,8,11,14,16-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\C=C\[C@H](O)CC |
| InChI | InChI=1S/C41H65O9P/c1-3-5-6-7-8-9-10-11-12-16-19-22-25-28-31-34-40(43)48-36-39(37-49-51(45,46)47)50-41(44)35-32-29-26-23-20-17-14-13-15-18-21-24-27-30-33-38(42)4-2/h5-6,8-9,11-12,14-15,17-18,23-24,26-27,30,33,38-39,42H,3-4,7,10,13,16,19-22,25,28-29,31-32,34-37H2,1-2H3,(H2,45,46,47)/b6-5-,9-8-,12-11-,17-14-,18-15-,26-23-,27-24-,33-30+/t38-,39-/m1/s1 |
| InChIKey | GZKHTDYIZQWNCF-ZZFNZOBNSA-N |
| XLogP | 10.03 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.94 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|