C41H69O9P — CID 156967198
[(2R)-2-[(Z)-octadec-9-enoyl]oxy-3-phosphonooxypropyl] (5Z,8Z,11Z,14Z,16E,18S)-18-hydroxyicosa-5,8,11,14,16-pentaenoate (PubChem CID 156967198) has the molecular formula C41H69O9P and a molecular weight of 736.97 g/mol. Its IUPAC name is [(2R)-2-[(Z)-octadec-9-enoyl]oxy-3-phosphonooxypropyl] (5Z,8Z,11Z,14Z,16E,18S)-18-hydroxyicosa-5,8,11,14,16-pentaenoate.
| Compound Name | [(2R)-2-[(Z)-octadec-9-enoyl]oxy-3-phosphonooxypropyl] (5Z,8Z,11Z,14Z,16E,18S)-18-hydroxyicosa-5,8,11,14,16-pentaenoate |
|---|---|
| PubChem CID | 156967198 |
| Molecular Formula | C41H69O9P |
| Molecular Weight | 736.97 g/mol |
| Exact Mass | 736.47 |
| IUPAC Name | [(2R)-2-[(Z)-octadec-9-enoyl]oxy-3-phosphonooxypropyl] (5Z,8Z,11Z,14Z,16E,18S)-18-hydroxyicosa-5,8,11,14,16-pentaenoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\C=C\[C@@H](O)CC)COP(=O)(O)O |
| InChI | InChI=1S/C41H69O9P/c1-3-5-6-7-8-9-10-11-12-17-20-23-26-29-32-35-41(44)50-39(37-49-51(45,46)47)36-48-40(43)34-31-28-25-22-19-16-14-13-15-18-21-24-27-30-33-38(42)4-2/h11-12,14-16,18,22,24-25,27,30,33,38-39,42H,3-10,13,17,19-21,23,26,28-29,31-32,34-37H2,1-2H3,(H2,45,46,47)/b12-11-,16-14-,18-15-,25-22-,27-24-,33-30+/t38-,39+/m0/s1 |
| InChIKey | PHMTZKYTNDYMFX-HDLGTVTASA-N |
| XLogP | 10.48 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.97 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|