C41H73O9P — CID 156967132
[(2R)-2-[(Z)-octadec-11-enoyl]oxy-3-phosphonooxypropyl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate (PubChem CID 156967132) has the molecular formula C41H73O9P and a molecular weight of 741.00 g/mol. Its IUPAC name is [(2R)-2-[(Z)-octadec-11-enoyl]oxy-3-phosphonooxypropyl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate.
| Compound Name | [(2R)-2-[(Z)-octadec-11-enoyl]oxy-3-phosphonooxypropyl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate |
|---|---|
| PubChem CID | 156967132 |
| Molecular Formula | C41H73O9P |
| Molecular Weight | 741.00 g/mol |
| Exact Mass | 740.50 |
| IUPAC Name | [(2R)-2-[(Z)-octadec-11-enoyl]oxy-3-phosphonooxypropyl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate |
| SMILES | CCCCCC/C=C\CCCCCCCCCC(=O)O[C@H](COC(=O)CCCC(O)/C=C/C=C/C/C=C/CCCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C41H73O9P/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-34-41(44)50-39(37-49-51(45,46)47)36-48-40(43)35-31-33-38(42)32-29-27-25-23-21-19-16-14-12-10-8-6-4-2/h13,15,19,21,25,27,29,32,38-39,42H,3-12,14,16-18,20,22-24,26,28,30-31,33-37H2,1-2H3,(H2,45,46,47)/b15-13-,21-19+,27-25+,32-29+/t38?,39-/m1/s1 |
| InChIKey | FFLYZSNHIJLVGL-KDHUHADSSA-N |
| XLogP | 10.93 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.00 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|