C37H63O10P — CID 156966482
[(2R)-1-phosphonooxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate (PubChem CID 156966482) has the molecular formula C37H63O10P and a molecular weight of 698.88 g/mol. Its IUPAC name is [(2R)-1-phosphonooxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate.
| Compound Name | [(2R)-1-phosphonooxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 156966482 |
| Molecular Formula | C37H63O10P |
| Molecular Weight | 698.88 g/mol |
| Exact Mass | 698.42 |
| IUPAC Name | [(2R)-1-phosphonooxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCC[C@H](O)/C=C/C=C\C/C=C\C=C\[C@H](O)CCCCC |
| InChI | InChI=1S/C37H63O10P/c1-3-5-7-8-9-10-11-12-16-19-23-29-36(40)45-31-35(32-46-48(42,43)44)47-37(41)30-24-28-34(39)27-22-18-15-13-14-17-21-26-33(38)25-20-6-4-2/h8-9,14-15,17-18,21-22,26-27,33-35,38-39H,3-7,10-13,16,19-20,23-25,28-32H2,1-2H3,(H2,42,43,44)/b9-8-,17-14-,18-15-,26-21+,27-22+/t33-,34-,35-/m1/s1 |
| InChIKey | YTZNGDAUOOFDST-VKKWKCPSSA-N |
| XLogP | 8.12 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.88 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|