C37H65O9P — CID 156966508
[(2R)-1-phosphonooxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate (PubChem CID 156966508) has the molecular formula C37H65O9P and a molecular weight of 684.89 g/mol. Its IUPAC name is [(2R)-1-phosphonooxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate.
| Compound Name | [(2R)-1-phosphonooxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate |
|---|---|
| PubChem CID | 156966508 |
| Molecular Formula | C37H65O9P |
| Molecular Weight | 684.89 g/mol |
| Exact Mass | 684.44 |
| IUPAC Name | [(2R)-1-phosphonooxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCC(O)/C=C/C=C/C/C=C/CCCCCCCC |
| InChI | InChI=1S/C37H65O9P/c1-3-5-7-9-11-13-15-16-18-19-21-23-25-28-34(38)29-27-31-37(40)46-35(33-45-47(41,42)43)32-44-36(39)30-26-24-22-20-17-14-12-10-8-6-4-2/h10,12,16,18,21,23,25,28,34-35,38H,3-9,11,13-15,17,19-20,22,24,26-27,29-33H2,1-2H3,(H2,41,42,43)/b12-10-,18-16+,23-21+,28-25+/t34?,35-/m1/s1 |
| InChIKey | BMCINQLXSCEKGE-PKHJBXPESA-N |
| XLogP | 9.37 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.89 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|