C41H65O9P — CID 156967516
[(2R)-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropyl] (6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoate (PubChem CID 156967516) has the molecular formula C41H65O9P and a molecular weight of 732.94 g/mol. Its IUPAC name is [(2R)-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropyl] (6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoate.
| Compound Name | [(2R)-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropyl] (6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 156967516 |
| Molecular Formula | C41H65O9P |
| Molecular Weight | 732.94 g/mol |
| Exact Mass | 732.44 |
| IUPAC Name | [(2R)-2-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy-3-phosphonooxypropyl] (6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C=C\C(O)CCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCC/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C41H65O9P/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-34-41(44)50-39(37-49-51(45,46)47)36-48-40(43)35-31-33-38(42)32-29-27-25-23-21-19-16-14-12-10-8-6-4-2/h6,8,11-14,17-19,21-22,24-25,27,29,32,38-39,42H,3-5,7,9-10,15-16,20,23,26,28,30-31,33-37H2,1-2H3,(H2,45,46,47)/b8-6-,13-11-,14-12-,18-17-,21-19-,24-22-,27-25-,32-29+/t38?,39-/m1/s1 |
| InChIKey | HBYXDUVXAWBQJX-TZBKKJPGSA-N |
| XLogP | 10.03 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.94 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|