C45H71O9P — CID 156968460
[(2R)-2-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxy-3-phosphonooxypropyl] (5Z,7Z,10Z,13Z,16Z,19Z)-4-hydroxydocosa-5,7,10,13,16,19-hexaenoate (PubChem CID 156968460) has the molecular formula C45H71O9P and a molecular weight of 787.03 g/mol. Its IUPAC name is [(2R)-2-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxy-3-phosphonooxypropyl] (5Z,7Z,10Z,13Z,16Z,19Z)-4-hydroxydocosa-5,7,10,13,16,19-hexaenoate.
| Compound Name | [(2R)-2-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxy-3-phosphonooxypropyl] (5Z,7Z,10Z,13Z,16Z,19Z)-4-hydroxydocosa-5,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 156968460 |
| Molecular Formula | C45H71O9P |
| Molecular Weight | 787.03 g/mol |
| Exact Mass | 786.48 |
| IUPAC Name | [(2R)-2-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxy-3-phosphonooxypropyl] (5Z,7Z,10Z,13Z,16Z,19Z)-4-hydroxydocosa-5,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C=C/C(O)CCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCC/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C45H71O9P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-45(48)54-43(41-53-55(49,50)51)40-52-44(47)39-38-42(46)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h6,8,11-14,17-20,23-26,30,32,34,36,42-43,46H,3-5,7,9-10,15-16,21-22,27-29,31,33,35,37-41H2,1-2H3,(H2,49,50,51)/b8-6-,13-11-,14-12-,19-17-,20-18-,25-23-,26-24-,32-30-,36-34-/t42?,43-/m1/s1 |
| InChIKey | ZPANWZJTGMIJCD-IJJFPABUSA-N |
| XLogP | 11.37 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.03 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|