C41H67O9P — CID 156967568
[(2R)-1-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy-3-phosphonooxypropan-2-yl] (5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoate (PubChem CID 156967568) has the molecular formula C41H67O9P and a molecular weight of 734.95 g/mol. Its IUPAC name is [(2R)-1-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy-3-phosphonooxypropan-2-yl] (5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoate.
| Compound Name | [(2R)-1-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy-3-phosphonooxypropan-2-yl] (5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 156967568 |
| Molecular Formula | C41H67O9P |
| Molecular Weight | 734.95 g/mol |
| Exact Mass | 734.45 |
| IUPAC Name | [(2R)-1-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy-3-phosphonooxypropan-2-yl] (5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCC/C=C\C/C=C\C/C=C\C=C\[C@@H](O)CCCCC |
| InChI | InChI=1S/C41H67O9P/c1-3-5-7-8-9-10-11-12-13-14-17-20-23-26-30-34-40(43)48-36-39(37-49-51(45,46)47)50-41(44)35-31-27-24-21-18-15-16-19-22-25-29-33-38(42)32-28-6-4-2/h5,7,9-10,12-13,15-16,21-22,24-25,29,33,38-39,42H,3-4,6,8,11,14,17-20,23,26-28,30-32,34-37H2,1-2H3,(H2,45,46,47)/b7-5-,10-9-,13-12-,16-15-,24-21-,25-22-,33-29+/t38-,39+/m0/s1 |
| InChIKey | BDKDYDHUGPDTEF-IFQZOZRZSA-N |
| XLogP | 10.26 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.95 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|