C41H65O10P — CID 156967728
[(2R)-1-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate (PubChem CID 156967728) has the molecular formula C41H65O10P and a molecular weight of 748.94 g/mol. Its IUPAC name is [(2R)-1-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate.
| Compound Name | [(2R)-1-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 156967728 |
| Molecular Formula | C41H65O10P |
| Molecular Weight | 748.94 g/mol |
| Exact Mass | 748.43 |
| IUPAC Name | [(2R)-1-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCC[C@H](O)/C=C/C=C\C/C=C\C=C\[C@H](O)CCCCC |
| InChI | InChI=1S/C41H65O10P/c1-3-5-7-8-9-10-11-12-13-14-15-16-20-23-27-33-40(44)49-35-39(36-50-52(46,47)48)51-41(45)34-28-32-38(43)31-26-22-19-17-18-21-25-30-37(42)29-24-6-4-2/h5,7,9-10,12-13,15-16,18-19,21-22,25-26,30-31,37-39,42-43H,3-4,6,8,11,14,17,20,23-24,27-29,32-36H2,1-2H3,(H2,46,47,48)/b7-5-,10-9-,13-12-,16-15-,21-18-,22-19-,30-25+,31-26+/t37-,38-,39-/m1/s1 |
| InChIKey | YWMNJKWBAVPUMB-YZGIHYLASA-N |
| XLogP | 9.00 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.94 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|