C43H65O10P — CID 156967725
[(2R)-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxy-3-phosphonooxypropyl] (5Z,7S,8E,10Z,13Z,15E,17R,19Z)-7,17-dihydroxydocosa-5,8,10,13,15,19-hexaenoate (PubChem CID 156967725) has the molecular formula C43H65O10P and a molecular weight of 772.96 g/mol. Its IUPAC name is [(2R)-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxy-3-phosphonooxypropyl] (5Z,7S,8E,10Z,13Z,15E,17R,19Z)-7,17-dihydroxydocosa-5,8,10,13,15,19-hexaenoate.
| Compound Name | [(2R)-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxy-3-phosphonooxypropyl] (5Z,7S,8E,10Z,13Z,15E,17R,19Z)-7,17-dihydroxydocosa-5,8,10,13,15,19-hexaenoate |
|---|---|
| PubChem CID | 156967725 |
| Molecular Formula | C43H65O10P |
| Molecular Weight | 772.96 g/mol |
| Exact Mass | 772.43 |
| IUPAC Name | [(2R)-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxy-3-phosphonooxypropyl] (5Z,7S,8E,10Z,13Z,15E,17R,19Z)-7,17-dihydroxydocosa-5,8,10,13,15,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)O[C@H](COC(=O)CCC/C=C\[C@H](O)/C=C/C=C\C/C=C\C=C\[C@H](O)C/C=C\CC)COP(=O)(O)O |
| InChI | InChI=1S/C43H65O10P/c1-3-5-7-8-9-10-11-12-13-14-15-16-20-23-29-36-43(47)53-41(38-52-54(48,49)50)37-51-42(46)35-30-24-28-34-40(45)33-27-22-19-17-18-21-26-32-39(44)31-25-6-4-2/h5-7,9-10,12-13,15-16,18-19,21-22,25-28,32-34,39-41,44-45H,3-4,8,11,14,17,20,23-24,29-31,35-38H2,1-2H3,(H2,48,49,50)/b7-5-,10-9-,13-12-,16-15-,21-18-,22-19-,25-6-,32-26+,33-27+,34-28-/t39-,40-,41-/m1/s1 |
| InChIKey | DJJMCGFMPZUGMA-XFKIBTTPSA-N |
| XLogP | 9.34 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.96 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|