C35H61O9P — CID 156970671
[(2R)-1-(10-methylundecanoyloxy)-3-phosphonooxypropan-2-yl] (5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoate (PubChem CID 156970671) has the molecular formula C35H61O9P and a molecular weight of 656.84 g/mol. Its IUPAC name is [(2R)-1-(10-methylundecanoyloxy)-3-phosphonooxypropan-2-yl] (5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoate.
| Compound Name | [(2R)-1-(10-methylundecanoyloxy)-3-phosphonooxypropan-2-yl] (5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 156970671 |
| Molecular Formula | C35H61O9P |
| Molecular Weight | 656.84 g/mol |
| Exact Mass | 656.41 |
| IUPAC Name | [(2R)-1-(10-methylundecanoyloxy)-3-phosphonooxypropan-2-yl] (5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoate |
| SMILES | CC(C)CCCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCO |
| InChI | InChI=1S/C35H61O9P/c1-32(2)26-22-18-15-16-19-23-27-34(37)42-30-33(31-43-45(39,40)41)44-35(38)28-24-20-14-12-10-8-6-4-3-5-7-9-11-13-17-21-25-29-36/h3,5-6,8-9,11-12,14,32-33,36H,4,7,10,13,15-31H2,1-2H3,(H2,39,40,41)/b5-3-,8-6-,11-9-,14-12-/t33-/m1/s1 |
| InChIKey | HQPKBEJUVIXDOA-ZGGZKPQJSA-N |
| XLogP | 8.45 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.84 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|