C33H61O9P — CID 156970725
[(2R)-2-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxy-3-phosphonooxypropyl] 10-methylundecanoate (PubChem CID 156970725) has the molecular formula C33H61O9P and a molecular weight of 632.82 g/mol. Its IUPAC name is [(2R)-2-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxy-3-phosphonooxypropyl] 10-methylundecanoate.
| Compound Name | [(2R)-2-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxy-3-phosphonooxypropyl] 10-methylundecanoate |
|---|---|
| PubChem CID | 156970725 |
| Molecular Formula | C33H61O9P |
| Molecular Weight | 632.82 g/mol |
| Exact Mass | 632.41 |
| IUPAC Name | [(2R)-2-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxy-3-phosphonooxypropyl] 10-methylundecanoate |
| SMILES | CCCCCC1OC1C/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCC(C)C)COP(=O)(O)O |
| InChI | InChI=1S/C33H61O9P/c1-4-5-16-22-30-31(42-30)23-18-13-8-6-7-9-15-20-25-33(35)41-29(27-40-43(36,37)38)26-39-32(34)24-19-14-11-10-12-17-21-28(2)3/h13,18,28-31H,4-12,14-17,19-27H2,1-3H3,(H2,36,37,38)/b18-13-/t29-,30?,31?/m1/s1 |
| InChIKey | SYKMWLSIENNAFC-VXKIAXTMSA-N |
| XLogP | 8.35 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.82 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|