C34H63O9P — CID 156970828
[(2R)-1-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]-3-phosphonooxypropan-2-yl] 11-methyldodecanoate (PubChem CID 156970828) has the molecular formula C34H63O9P and a molecular weight of 646.84 g/mol. Its IUPAC name is [(2R)-1-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]-3-phosphonooxypropan-2-yl] 11-methyldodecanoate.
| Compound Name | [(2R)-1-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]-3-phosphonooxypropan-2-yl] 11-methyldodecanoate |
|---|---|
| PubChem CID | 156970828 |
| Molecular Formula | C34H63O9P |
| Molecular Weight | 646.84 g/mol |
| Exact Mass | 646.42 |
| IUPAC Name | [(2R)-1-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]-3-phosphonooxypropan-2-yl] 11-methyldodecanoate |
| SMILES | CCCCC/C=C\CC1OC1CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCCCCC(C)C |
| InChI | InChI=1S/C34H63O9P/c1-4-5-6-7-13-18-23-31-32(43-31)24-19-14-11-16-20-25-33(35)40-27-30(28-41-44(37,38)39)42-34(36)26-21-15-10-8-9-12-17-22-29(2)3/h13,18,29-32H,4-12,14-17,19-28H2,1-3H3,(H2,37,38,39)/b18-13-/t30-,31?,32?/m1/s1 |
| InChIKey | YQZBNAIFBADWRV-MNOAEAQGSA-N |
| XLogP | 8.74 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.84 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|