C44H77O11P — CID 156972334
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (5Z,8Z,11Z,14Z,18S)-18-hydroxyicosa-5,8,11,14-tetraenoate (PubChem CID 156972334) has the molecular formula C44H77O11P and a molecular weight of 813.06 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (5Z,8Z,11Z,14Z,18S)-18-hydroxyicosa-5,8,11,14-tetraenoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (5Z,8Z,11Z,14Z,18S)-18-hydroxyicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 156972334 |
| Molecular Formula | C44H77O11P |
| Molecular Weight | 813.06 g/mol |
| Exact Mass | 812.52 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (5Z,8Z,11Z,14Z,18S)-18-hydroxyicosa-5,8,11,14-tetraenoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CC[C@@H](O)CC)COP(=O)(O)OC[C@@H](O)CO |
| InChI | InChI=1S/C44H77O11P/c1-3-5-6-7-8-9-10-11-12-17-20-23-26-29-32-35-44(49)55-42(39-54-56(50,51)53-37-41(47)36-45)38-52-43(48)34-31-28-25-22-19-16-14-13-15-18-21-24-27-30-33-40(46)4-2/h11-12,14-16,18,22,24-25,27,40-42,45-47H,3-10,13,17,19-21,23,26,28-39H2,1-2H3,(H,50,51)/b12-11-,16-14-,18-15-,25-22-,27-24-/t40-,41-,42+/m0/s1 |
| InChIKey | OKIXMLWONKBVJB-MVYLSJIOSA-N |
| XLogP | 10.08 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.06 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|