C44H77O12P — CID 156972360
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate (PubChem CID 156972360) has the molecular formula C44H77O12P and a molecular weight of 829.06 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate |
|---|---|
| PubChem CID | 156972360 |
| Molecular Formula | C44H77O12P |
| Molecular Weight | 829.06 g/mol |
| Exact Mass | 828.52 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate |
| SMILES | CCCCC/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C44H77O12P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-21-27-33-44(50)56-42(38-55-57(51,52)54-36-41(48)35-45)37-53-43(49)34-28-32-40(47)31-26-23-22-25-30-39(46)29-24-20-10-8-6-4-2/h14-15,20,22-26,30-31,39-42,45-48H,3-13,16-19,21,27-29,32-38H2,1-2H3,(H,51,52)/b15-14-,23-22+,24-20-,30-25+,31-26-/t39-,40-,41+,42-/m1/s1 |
| InChIKey | AKFNWBHOHNRKEY-DOPNVCQWSA-N |
| XLogP | 9.05 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.06 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|